
CAS 1148130-31-7
:Methyl cis-3-hydroxycyclobutaneacetate
Description:
Methyl cis-3-hydroxycyclobutaneacetate is an organic compound characterized by its unique cyclic structure and functional groups. It features a cyclobutane ring, which is a four-membered carbon ring, and a hydroxyl group (-OH) at the 3-position, contributing to its reactivity and potential for hydrogen bonding. The acetate moiety indicates the presence of an ester functional group, which can influence its solubility and volatility. This compound is likely to exhibit moderate polarity due to the hydroxyl group, making it soluble in polar solvents while retaining some hydrophobic characteristics from the cyclobutane structure. Its stereochemistry, indicated by the "cis" designation, suggests that substituents on the cyclobutane ring are oriented on the same side, which can affect its physical properties and reactivity. Methyl cis-3-hydroxycyclobutaneacetate may have applications in organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules. However, specific reactivity and stability would depend on the surrounding conditions and the presence of other functional groups.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c1-10-7(9)4-5-2-6(8)3-5/h5-6,8H,2-4H2,1H3/t5-,6+
InChI key:InChIKey=XMAIKRHUQZOPSW-OLQVQODUNA-N
SMILES:C(C(OC)=O)[C@@H]1C[C@H](O)C1
Synonyms:- Methyl cis-3-hydroxycyclobutaneacetate
- (cis-3-Hydroxycyclobutyl)acetic acid methyl ester
- Cyclobutaneacetic acid, 3-hydroxy-, methyl ester, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.