CAS 114815-74-6
:Poly(3-thiopheneacetic acid)
Description:
Poly(3-thiopheneacetic acid) is a conducting polymer characterized by its unique structure, which incorporates thiophene units linked to acetic acid groups. This polymer exhibits both electrical conductivity and solubility in various solvents, making it suitable for applications in organic electronics, sensors, and bioelectronics. The presence of the thiophene moiety contributes to its conjugated system, allowing for effective charge transport. Additionally, the carboxylic acid groups enhance its hydrophilicity and facilitate interactions with biological systems, which can be advantageous in biomedical applications. Poly(3-thiopheneacetic acid) can be synthesized through polymerization techniques, such as oxidative polymerization or electrochemical methods, and its properties can be tailored by adjusting the polymerization conditions or by copolymerization with other monomers. The material's stability, processability, and tunable properties make it a subject of interest in research and development for advanced materials in various fields, including energy storage and conversion, as well as in the development of functional coatings.
Formula:(C6H6O2S)x
InChI:InChI=1S/C6H6O2S/c7-6(8)3-5-1-2-9-4-5/h1-2,4H,3H2,(H,7,8)
InChI key:InChIKey=RCNOGGGBSSVMAS-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=CSC1
Synonyms:- Poly(3-thienylacetic acid)
- 3-Thiopheneacetic acid, homopolymer
- Poly(3-α-carboxymethylthiophene)
- Poly(3-α-carboxylmethylthiophene)
- Poly(thiophene-3-acetic acid)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
