CAS 114818-11-0
:2-(4-FLUOROCYCLOHEXYL)-5-PENTYL-1,3-DIOXANE
Description:
2-(4-Fluorocyclohexyl)-5-pentyl-1,3-dioxane is a chemical compound characterized by its unique molecular structure, which includes a dioxane ring and a cyclohexyl group substituted with a fluorine atom. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. The pentyl group contributes to the hydrophobic characteristics of the molecule, potentially affecting its solubility and interaction with biological membranes. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its dioxane moiety can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Additionally, the compound's stability, reactivity, and potential applications in drug development or as a synthetic intermediate can be influenced by the arrangement of its functional groups. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or environmental impact.
Formula:C15H27FO2
InChI:InChI=1/C15H27FO2/c1-2-3-4-5-12-10-17-15(18-11-12)13-6-8-14(16)9-7-13/h12-15H,2-11H2,1H3
SMILES:CCCCCC1COC(C2CCC(CC2)F)OC1
Synonyms:- 2-(4-Fluorocyclohexyl)-5-pentyl-1,3-dioxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
