CAS 114834-02-5

4-Chloro-6-(1H-imidazol-1-yl)pyrimide

Description:

4-Chloro-6-(1H-imidazol-1-yl)pyrimidine is a heterocyclic organic compound characterized by the presence of both pyrimidine and imidazole rings. It features a chlorine substituent at the 4-position of the pyrimidine ring and an imidazole group at the 6-position, contributing to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial and antifungal agents. The presence of the imidazole moiety can enhance its interaction with biological targets, while the chlorine atom may influence its reactivity and stability. Additionally, 4-Chloro-6-(1H-imidazol-1-yl)pyrimidine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Its molecular structure and functional groups allow for potential applications in medicinal chemistry and agrochemicals.

Formula: C₇H₅ClN₄

InChI: InChI=1/C7H5ClN4/c8-6-3-7(11-4-10-6)12-2-1-9-5-12/h1-5H

SMILES: c1cn(cn1)c1cc(Cl)ncn1

Synonyms:

• 4-Chloro-6-(1H-imidazol-1-yl)pyrimidine

4-chloro-6-(imidazol-1-yl)pyrimidine

CAS: 114834-02-5

Formula: C₇H₅ClN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.5944

Ref: IN-DA000FBN

4-Chloro-6-(1h-imidazol-1-yl)pyrimidine

CAS: 114834-02-5

4-Chloro-6-(1h-imidazol-1-yl)pyrimidine

Purity: 97%

Molecular weight: 180.59g/mol

Ref: 54-OR322318

4-Chloro-6-(1H-imidazol-1-yl)pyrimidine

CAS: 114834-02-5

Formula: C₇H₅ClN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.6

Ref: 10-F011634

4-Chloro-6-imidazol-1-yl-pyrimidine

CAS: 114834-02-5

4-Chloro-6-imidazol-1-yl-pyrimidine is a quaternary ammonium compound that can be used to make antireflection coatings. It has been shown to have a high degree of compatibility with polymers, such as allyl carbonate, which are used in functional groups. 4-Chloro-6-imidazol-1-yl-pyrimidine has also been shown to react with stannous octoate, and the reaction time is dependent on the concentration of both compounds. This molecule has been found to be biodegradable and liquid crystal compositions can be made from it by changing the ratio of molecules to liquid crystals. 4-Chloro-6-imidazol-1-yl pyrimidine reacts with hydroxyl groups in epoxy resins and diolefinic hydrocarbons, forming crosslinks in sealants or coatings. The sealant

Formula: C₇H₅ClN₄

Purity: Min. 95%

Molecular weight: 180.59 g/mol

Ref: 3D-NC57449