CAS 114849-59-1
:2-fluoro-2',3'-dideoxyadenosine
Description:
2-Fluoro-2',3'-dideoxyadenosine (CAS 114849-59-1) is a synthetic nucleoside analog of adenosine, characterized by the presence of a fluorine atom at the 2-position of the ribose sugar and the absence of hydroxyl groups at the 2' and 3' positions. This modification enhances its stability and resistance to enzymatic degradation, making it a valuable compound in antiviral and anticancer research. The compound exhibits properties typical of nucleosides, including the ability to incorporate into nucleic acids, potentially disrupting normal cellular processes. Its mechanism of action often involves inhibition of viral replication or interference with DNA synthesis in cancer cells. As a polar molecule, it is soluble in water and other polar solvents, which facilitates its use in biological studies. The compound's pharmacological profile is of interest in the development of therapeutic agents, particularly in the context of HIV treatment and other viral infections. Overall, 2-fluoro-2',3'-dideoxyadenosine represents a significant tool in medicinal chemistry and molecular biology.
Formula:C10H12FN5O2
InChI:InChI=1/C10H12FN5O2/c11-10-14-8(12)7-9(15-10)16(4-13-7)6-2-1-5(3-17)18-6/h4-6,17H,1-3H2,(H2,12,14,15)/t5-,6+/m0/s1
Synonyms:- 2-Fdda
- Adenosine, 2',3'-dideoxy-2-fluoro-
- [(2S,5R)-5-(6-amino-2-fluoro-9H-purin-9-yl)tetrahydrofuran-2-yl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.