CymitQuimica logo

CAS 114861-22-2

:

1,2-O-Isopropylidene-a-L-xylofuranose

Description:
1,2-O-Isopropylidene-α-L-xylofuranose is a carbohydrate derivative characterized by its furanose ring structure, which is a five-membered cyclic form of sugars. This compound features an isopropylidene protecting group at the anomeric carbon, which enhances its stability and solubility in organic solvents. The presence of the α configuration indicates that the hydroxyl group at the anomeric carbon is oriented downward in the Haworth projection. This compound is typically used in organic synthesis, particularly in the preparation of glycosides and other carbohydrate derivatives. Its reactivity is influenced by the functional groups present, allowing for various chemical transformations. Additionally, it is important in the study of carbohydrate chemistry and can serve as an intermediate in the synthesis of more complex sugar molecules. The compound is generally stable under standard laboratory conditions but should be handled with care, as with all chemical substances, to avoid potential hazards.
Formula:C8H14O5
InChI:InChI=1S/C8H14O5/c1-8(2)12-6-5(10)4(3-9)11-7(6)13-8/h4-7,9-10H,3H2,1-2H3/t4-,5+,6-,7-/m0/s1
InChI key:JAUQZVBVVJJRKM-VZFHVOOUSA-N
SMILES:CC1(O[C@H]2[C@@H]([C@@H](O[C@H]2O1)CO)O)C
Found 6 products.