CymitQuimica logo

CAS 114872-98-9

:

D-2,4-Dichlorophe

Description:
D-2,4-Dichlorophen is a chemical compound characterized by its chlorinated aromatic structure, which typically exhibits properties associated with halogenated phenols. It is known for its potential applications in various fields, including agriculture and pharmaceuticals. The presence of chlorine atoms in the 2 and 4 positions of the phenolic ring contributes to its reactivity and stability, influencing its behavior in chemical reactions and interactions with biological systems. This compound may exhibit antimicrobial or herbicidal properties, making it of interest in pest control. Additionally, its solubility characteristics can vary, often being more soluble in organic solvents than in water, which affects its environmental behavior and bioavailability. Safety data sheets would typically indicate precautions for handling due to potential toxicity or environmental impact. As with many chlorinated compounds, it is essential to consider its persistence in the environment and potential for bioaccumulation. Always refer to specific regulatory guidelines and safety data for detailed handling and usage information.
Formula:C9H9Cl2NO2
InChI:InChI=1S/C9H9Cl2NO2/c10-6-2-1-5(7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14)/t8-/m1/s1
InChI key:GWHQTNKPTXDNRM-MRVPVSSYSA-N
SMILES:C1=CC(=C(C=C1Cl)Cl)C[C@H](C(=O)O)N
Synonyms:
  • D-2,4-Dichlorophenylalanine
  • 2,4-Dichloro-D-phenylalanine
Found 4 products.