CAS 114873-02-8
:BOC-L-2-Chlorophe
Description:
BOC-L-2-Chlorophenylalanine, commonly referred to as BOC-L-2-Chlorophe, is a derivative of the amino acid phenylalanine, where a tert-butyloxycarbonyl (BOC) protecting group is attached to the amino group, and a chlorine atom is substituted at the ortho position of the phenyl ring. This compound is typically used in peptide synthesis and other organic chemistry applications due to its ability to protect the amino group during reactions. The presence of the chlorine atom can influence the compound's reactivity and solubility, making it a valuable intermediate in the synthesis of more complex molecules. BOC-L-2-Chlorophenylalanine is often utilized in the development of pharmaceuticals and biologically active compounds, as the modifications can enhance biological activity or selectivity. As with many chemical substances, proper handling and safety precautions are essential, as it may pose hazards typical of organic compounds, including potential toxicity and reactivity.
Formula:C14H18ClNO4
InChI:InChI=1/C14H18ClNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-6-4-5-7-10(9)15/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1
SMILES:CC(C)(C)OC(=N[C@H](Cc1ccccc1Cl)C(=O)O)O
Synonyms:- Boc-L-2-Chlorophenylalanine
- Boc-2-Chloro-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Phenylalanine, 2-chloro-N-[(1,1-dimethylethoxy)carbonyl]-
CAS:Formula:C14H18ClNO4Purity:97%Color and Shape:SolidMolecular weight:299.75002-Chloro-L-phenylalanine, N-BOC protected
CAS:2-Chloro-L-phenylalanine, N-BOC protectedFormula:C14H18ClNO4Purity:96%Color and Shape: off-white powderMolecular weight:299.75g/molBoc-2-chloro-L-phenylalanine
CAS:Formula:C14H18ClNO4Purity:98%Color and Shape:SolidMolecular weight:299.75Boc-2-chloro-L-phenylalanine
CAS:Boc-2-chloro-L-phenylalanine is a versatile building block that can be used as an intermediate or a reaction component. It has the following properties: CAS No. 114873-02-8, fine chemical, useful scaffold, versatile building block, useful intermediate, research chemicals, reaction component, speciality chemical, complex compound, useful building block. Boc-2-chloro-L-phenylalanine is a high quality reagent that can be used for research purposes.Formula:C14H18ClNO4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:299.75 g/mol




