CAS 114882-45-0
:4-nitrophenyl-N,N',N',N'',N''-pentaacetyl-beta-chitopentaoside
Description:
4-Nitrophenyl-N,N',N',N'',N''-pentaacetyl-beta-chitopentaoside is a synthetic compound derived from chitosan, a biopolymer obtained from chitin. This substance features a pentaacetylated structure, indicating that five acetyl groups are attached to the chitopentaoside backbone, which consists of five N-acetylglucosamine units linked by beta-glycosidic bonds. The presence of the 4-nitrophenyl group suggests that this compound may exhibit specific optical properties and can be used as a chromogenic substrate in various biochemical assays. Its acetylation enhances solubility and stability, making it suitable for applications in drug delivery and bioconjugation. The compound's molecular structure contributes to its potential interactions with biological systems, including enzyme activity modulation and cell membrane permeability. Overall, 4-nitrophenyl-N,N',N',N'',N''-pentaacetyl-beta-chitopentaoside represents a versatile chemical entity with applications in medicinal chemistry and biotechnology.
Formula:C46H70N6O28
InChI:InChI=1/C46H70N6O28/c1-15(58)47-27-33(64)32(63)22(10-53)72-43(27)77-39-24(12-55)74-45(29(35(39)66)49-17(3)60)79-41-26(14-57)76-46(31(37(41)68)51-19(5)62)80-40-25(13-56)75-44(30(36(40)67)50-18(4)61)78-38-23(11-54)73-42(28(34(38)65)48-16(2)59)71-21-8-6-20(7-9-21)52(69)70/h6-9,22-46,53-57,63-68H,10-14H2,1-5H3,(H,47,58)(H,48,59)(H,49,60)(H,50,61)(H,51,62)/t22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40?,41-,42-,43+,44+,45+,46+/m1/s1
Synonyms:- 4-Nitrophenyl penta-N-acetylchitopentaoside
- Nnnnpbc
- Pnp-(glcnac)5
- beta-D-Glucopyranoside, 4-nitrophenyl-O-2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl-(1-4) O-2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl-(1-4) O-2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl-(1-4) O-2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl-(1-4)-2-(acetylamino)-2-deoxy-
- 4-Nitrophenyl-N,N',N'',N''',N''''-pentaacetyl-beta-chitopentaoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
p-Nitrophenyl Penta-N-acetyl-β-chitopentaoside
CAS:Controlled ProductFormula:C46H70N6O28Color and Shape:NeatMolecular weight:1155.071
