CAS 114896-32-1
:16-MERCAPTO-1-HEXADECANOL
Description:
16-Mercapto-1-hexadecanol, with the CAS number 114896-32-1, is a long-chain aliphatic thiol characterized by the presence of a hydroxyl group (-OH) and a thiol group (-SH) at opposite ends of a 16-carbon chain. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits properties common to thiols, such as a strong, often unpleasant odor, and is known for its reactivity, particularly in forming disulfide bonds when oxidized. The hydroxyl group contributes to its hydrophilicity, allowing it to interact with polar solvents and surfaces, while the long hydrophobic carbon chain enhances its compatibility with non-polar environments. This dual nature makes 16-mercapto-1-hexadecanol useful in various applications, including as a coupling agent in surface modification, in the synthesis of nanoparticles, and in the formulation of specialty chemicals. Its ability to self-assemble on surfaces also makes it valuable in nanotechnology and materials science.
Formula:C16H34OS
InChI:InChI=1/C16H34OS/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18/h17-18H,1-16H2
SMILES:C(CCCCCCCCS)CCCCCCCO
Synonyms:- 16-Mercaptohexadecan-1-Ol
- 16-Sulfanylhexadecan-1-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
16-Mercapto-1-hexadecanol
CAS:<p>16-Mercapto-1-hexadecanol is a lipid. It is a component of human serum, and has been shown to be generated in the liver by hydrolysis of 16-hydroxylated cholesterol. 16-Mercapto-1-hexadecanol is also an activating agent for monoclonal antibodies that are used as therapeutic agents in cancer treatment. The activation energy for this process is approximately -5 kcal/mol. This compound has been used to study the thermodynamic properties of ferrocene. 16-Mercapto-1-hexadecanol can be synthesized from the reaction of ferrocene with hexadecanoic acid and hydrogen peroxide in water. The structural formula for this compound has been determined using gel chromatography and it contains two hydrogen bonds within its structure. Analytical chemistry techniques such as kinetic data and kinetic studies have been performed on this compound, which can be immobilized on a monolayer or x ray</p>Formula:C16H34OSPurity:Min. 95%Color and Shape:PowderMolecular weight:274.51 g/mol16-Mercaptohexadecan-1-ol
CAS:Controlled ProductFormula:C16H34OSColor and Shape:NeatMolecular weight:274.506




