CAS 114897-85-7
:(4-benzyl-1-oxophthalazin-2(1H)-yl)acetic acid
Description:
(4-benzyl-1-oxophthalazin-2(1H)-yl)acetic acid, identified by its CAS number 114897-85-7, is a chemical compound that features a phthalazinone core substituted with a benzyl group and an acetic acid moiety. This compound is characterized by its unique structural framework, which includes a phthalazinone ring system that contributes to its potential biological activity. The presence of the benzyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. The carboxylic acid functional group in the acetic acid portion may impart acidic properties, allowing for ionization under physiological conditions. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, (4-benzyl-1-oxophthalazin-2(1H)-yl)acetic acid represents a class of compounds that could be explored for therapeutic applications, although specific biological data would be necessary to elucidate its efficacy and safety profile.
Formula:C17H14N2O3
InChI:InChI=1/C17H14N2O3/c20-16(21)11-19-17(22)14-9-5-4-8-13(14)15(18-19)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,20,21)
SMILES:c1ccc(cc1)Cc1c2ccccc2c(=O)n(CC(=O)O)n1
Synonyms:- 2(1H)-Phthalazineacetic acid, 1-oxo-4-(phenylmethyl)-
- (4-Benzyl-1-oxophthalazin-2(1H)-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
