CAS 114897-92-6
:4-Bromo-2-fluorophenylacetic acid
Description:
4-Bromo-2-fluorophenylacetic acid is an organic compound characterized by the presence of both bromine and fluorine substituents on a phenyl ring, along with an acetic acid functional group. Its molecular structure features a bromine atom at the para position and a fluorine atom at the ortho position relative to the acetic acid moiety. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of halogens can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which can be explored for pharmaceutical applications. Its CAS number, 114897-92-6, is a unique identifier that facilitates its identification in chemical databases and literature. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C8H6BrFO2
InChI:InChI=1/C8H6BrFO2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12)
SMILES:c1cc(cc(c1CC(=O)O)F)Br
Synonyms:- (4-Bromo-2-fluorophenyl)acetic acid
- 2-(4-Bromo-2-Fluorophenyl)Acetic Acid
- Benzeneacetic acid, 4-bromo-2-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-2-fluorophenylacetic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H6BrFO2Purity:98%Molecular weight:233.04Benzeneacetic acid, 4-bromo-2-fluoro-
CAS:Formula:C8H6BrFO2Purity:98%Color and Shape:SolidMolecular weight:233.03444-Bromo-2-fluorophenylacetic acid
CAS:4-Bromo-2-fluorophenylacetic acidFormula:C8H6BrFO2Purity:≥95%Color and Shape: off-white powderMolecular weight:233.03g/mol4-Bromo-2-fluorophenylacetic acid
CAS:Formula:C8H6BrFO2Purity:97%Color and Shape:SolidMolecular weight:233.036



