CAS 114920-51-3

Benzo[c]thiophene-5-sulfonyl chloride, 1,3-dihydro-, 2,2-dioxide

Description:

Benzo[c]thiophene-5-sulfonyl chloride, 1,3-dihydro-, 2,2-dioxide, with CAS number 114920-51-3, is a chemical compound characterized by its sulfonyl chloride functional group attached to a benzo[c]thiophene structure. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and reactivity due to the presence of the sulfonyl chloride group, which is known for its electrophilic nature. The 1,3-dihydro configuration suggests that it may exist in a cyclic form, contributing to its unique chemical behavior. The sulfonyl chloride moiety makes it a useful intermediate in organic synthesis, particularly in the formation of sulfonamides and other derivatives. Additionally, the presence of the 2,2-dioxide indicates that it may have enhanced solubility and reactivity in various solvents. Overall, this compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex chemical entities.

Formula: C₈H₇ClO₄S₂

InChI: InChI=1S/C8H7ClO4S2/c9-15(12,13)8-2-1-6-4-14(10,11)5-7(6)3-8/h1-3H,4-5H2

InChI key: InChIKey=VIYDGWAWUOVMDW-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C2C(CS(=O)(=O)C2)=CC1

Synonyms:

• Benzo[c]thiophene-5-sulfonyl chloride, 1,3-dihydro-, 2,2-dioxide
• 2,2-Dioxo-1,3-dihydro-2λ6-benzothiophene-5-sulfonyl chloride

1,​3-​Dihydro-​benzo[c]​thiophene-​5-​sulfonyl chloride 2,​2-​dioxide

CAS: 114920-51-3

Versatile small molecule scaffold

Formula: C₈H₇ClO₄S₂

Purity: Min. 95%

Molecular weight: 266.7 g/mol

Ref: 3D-PEA92051