CymitQuimica logo

CAS 1149352-14-6

:

4,5,6,7-Tetrahydro-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoindole

Description:
4,5,6,7-Tetrahydro-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoindole is a complex organic compound characterized by its unique structural features, including a tetrahydroisoindole core and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. The compound is likely to exhibit moderate polarity due to the presence of both hydrophobic hydrocarbon regions and polar functional groups. Its molecular structure may confer specific reactivity patterns, making it of interest in medicinal chemistry and material science. Additionally, the compound's stability and solubility characteristics would depend on the solvent system and environmental conditions. As with many organoboron compounds, it may also exhibit interesting photophysical properties, which could be leveraged in various applications, including fluorescence and sensor technology. Overall, this compound represents a valuable building block in synthetic organic chemistry.
Formula:C15H24BNO2
InChI:InChI=1S/C15H24BNO2/c1-14(2)15(3,4)19-16(18-14)13-12-9-7-6-8-11(12)10-17(13)5/h10H,6-9H2,1-5H3
InChI key:InChIKey=UMPFBGNECCUNAR-UHFFFAOYSA-N
SMILES:CN1C(B2OC(C)(C)C(C)(C)O2)=C3C(=C1)CCCC3
Synonyms:
  • 4,5,6,7-Tetrahydro-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoindole
  • 2-Methyl-1-(tetramethyl-1,3,2-dioxaborolan-2-yl)-4,5,6,7-tetrahydro-2H-isoindole
  • 2H-Isoindole, 4,5,6,7-tetrahydro-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.