CymitQuimica logo

CAS 1149360-33-7

:

Methyl N-[1-methyl-6-(propylthio)-1H-benzimidazol-2-yl]carbamate

Description:
Methyl N-[1-methyl-6-(propylthio)-1H-benzimidazol-2-yl]carbamate, identified by its CAS number 1149360-33-7, is a chemical compound that belongs to the class of benzimidazole derivatives. This substance typically exhibits characteristics such as a complex molecular structure, which includes a benzimidazole core substituted with a methyl group and a propylthio group. The presence of the carbamate functional group suggests potential applications in medicinal chemistry, particularly as a bioactive agent. Compounds of this nature may demonstrate various biological activities, including antifungal, antibacterial, or herbicidal properties, depending on their specific structural features. The solubility and stability of this compound can vary based on environmental conditions, such as pH and temperature. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C13H17N3O2S
InChI:InChI=1S/C13H17N3O2S/c1-4-7-19-9-5-6-10-11(8-9)16(2)12(14-10)15-13(17)18-3/h5-6,8H,4,7H2,1-3H3,(H,14,15,17)
InChI key:InChIKey=KRLHNUUDNZEURU-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1NC(OC)=O)=CC=C(SCCC)C2
Synonyms:
  • Methyl N-[1-methyl-6-(propylthio)-1H-benzimidazol-2-yl]carbamate
  • Carbamic acid, N-[1-methyl-6-(propylthio)-1H-benzimidazol-2-yl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.