CAS 1149379-05-4

6-Fluoro-3-iodo-2-methylbenzenemethanol

Description:

6-Fluoro-3-iodo-2-methylbenzenemethanol is an organic compound characterized by the presence of a benzene ring substituted with a fluorine atom, an iodine atom, and a hydroxymethyl group. The molecular structure indicates that it has both halogen substituents and a functional alcohol group, which can influence its reactivity and solubility. The presence of the fluorine atom typically enhances the compound's lipophilicity, while the iodine atom may contribute to its reactivity in nucleophilic substitution reactions. The hydroxymethyl group (-CH2OH) suggests potential for hydrogen bonding, which can affect the compound's physical properties, such as boiling point and solubility in polar solvents. This compound may be of interest in medicinal chemistry and material science due to its unique combination of functional groups, which can lead to diverse biological activities and applications. Additionally, the specific arrangement of substituents on the benzene ring can influence its electronic properties and steric interactions, making it a candidate for further study in various chemical contexts.

Formula: C₈H₈FIO

InChI: InChI=1S/C8H8FIO/c1-5-6(4-11)7(9)2-3-8(5)10/h2-3,11H,4H2,1H3

InChI key: InChIKey=GGIVYTZLWMFBEK-UHFFFAOYSA-N

SMILES: C(O)C1=C(C)C(I)=CC=C1F

Synonyms:

• Benzenemethanol, 6-fluoro-3-iodo-2-methyl-
• (6-Fluoro-3-iodo-2-methylphenyl)methanol
• 6-Fluoro-3-iodo-2-methylbenzenemethanol