
CAS 114951-20-1
:5-Hydroxy-2-methylpentanoic acid
Description:
5-Hydroxy-2-methylpentanoic acid, with the CAS number 114951-20-1, is an organic compound characterized by its carboxylic acid functional group and a hydroxyl group. This compound features a five-carbon chain with a methyl group and a hydroxyl group positioned on the second and fifth carbons, respectively. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both the hydroxyl and carboxylic acid groups suggests that it can participate in hydrogen bonding, which may influence its solubility in polar solvents like water. This compound may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and biochemistry. Its structural features suggest potential applications in synthesis and as a building block for more complex molecules. As with many organic acids, it may have a sour taste and could be corrosive in concentrated forms. Proper handling and storage conditions are essential to ensure safety and stability.
Formula:C6H12O3
InChI:InChI=1S/C6H12O3/c1-5(6(8)9)3-2-4-7/h5,7H,2-4H2,1H3,(H,8,9)
InChI key:InChIKey=YUCINKYUVOIMER-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CCCO)C
Synonyms:- 5-Hydroxy-2-methylpentanoic acid
- Pentanoic acid, 5-hydroxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.