CymitQuimica logo

CAS 114959-37-4

:

Cyclopent[hi]acephenanthrylene

Description:
Cyclopent[hi]acephenanthrylene is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused ring structure, which includes a cyclopentane moiety integrated into a larger phenanthrene framework. This compound exhibits typical properties associated with PAHs, such as being hydrophobic and having a planar structure, which contributes to its potential for strong π-π stacking interactions. It is generally insoluble in water but soluble in organic solvents, reflecting its non-polar nature. Cyclopent[hi]acephenanthrylene may exhibit interesting electronic properties, making it a subject of study in organic electronics and materials science. Its unique structure can influence its reactivity and stability, and it may participate in various chemical reactions typical of aromatic compounds, such as electrophilic substitution. Additionally, due to its polycyclic nature, it may have implications in environmental chemistry, particularly concerning its persistence and potential toxicity. Overall, this compound represents a fascinating area of research within the field of organic chemistry and materials science.
Formula:C18H10
InChI:InChI=1S/C18H10/c1-3-11-7-9-15-16-10-8-12-4-2-6-14(18(12)16)13(5-1)17(11)15/h1-10H
InChI key:InChIKey=OGSMXDUSWZTIEB-UHFFFAOYSA-N
SMILES:C12=C3C4=C5C(=C1C=CC=C2C=C3)C=CC=C5C=C4
Synonyms:
  • Cyclopent[hi]acephenanthrylene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.