CAS 114971-53-8
:2,5-DIMETHYL-4-IODOPHENOL
Description:
2,5-Dimethyl-4-iodophenol is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) attached to a benzene ring that is further substituted with two methyl groups and one iodine atom. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the iodine atom enhances its reactivity, making it useful in electrophilic substitution reactions. The methyl groups contribute to the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the phenolic nature of the compound imparts certain antioxidant properties, which may be relevant in various chemical and biological contexts. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, 2,5-dimethyl-4-iodophenol is a versatile compound with significant implications in chemical research and industrial applications.
Formula:C8H9IO
InChI:InChI=1/C8H9IO/c1-5-4-8(10)6(2)3-7(5)9/h3-4,10H,1-2H3
SMILES:Cc1cc(c(C)cc1I)O
Synonyms:- 4-Iodo-2,5-Dimethylphenol
- 2,5-Dimethyl-4-iodophenol 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Iodo-2,5-dimethylphenol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H9IOPurity:98%Molecular weight:248.06Phenol, 4-iodo-2,5-dimethyl-
CAS:Formula:C8H9IOPurity:95%Color and Shape:SolidMolecular weight:248.06092,5-Dimethyl-4-iodophenol
CAS:2,5-Dimethyl-4-iodophenolPurity:97%Color and Shape:Orange PowderMolecular weight:248.06g/mol



