CAS 114976-76-0
:1,'-dideoxy-1,4-imino-D-mannitol*hydorchloride
Description:
1,'-Dideoxy-1,4-imino-D-mannitol hydrochloride is a chemical compound characterized by its structural features, which include a dideoxy sugar backbone and an imino group. This compound is a derivative of mannitol, a sugar alcohol, and is notable for its potential biological activity, particularly in the context of medicinal chemistry and pharmacology. The presence of the imino group may influence its interaction with biological targets, potentially affecting its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, which is advantageous for various applications, including drug formulation. The compound's specific stereochemistry and functional groups contribute to its unique properties, making it of interest in research related to carbohydrate chemistry and therapeutic development. Its CAS number, 114976-76-0, allows for precise identification in chemical databases and literature, facilitating further study and application in scientific research.
Formula:C6H14ClNO4
InChI:InChI=1/C6H13NO4.ClH/c8-2-4(10)5-6(11)3(9)1-7-5;/h3-11H,1-2H2;1H/t3-,4-,5-,6-;/m1./s1
SMILES:C1[C@H]([C@H]([C@@H]([C@@H](CO)O)N1)O)O.Cl
Synonyms:- 1,4-Dideoxy-1,4-imino-D-mannitol, HCl
- (2R,3S,4R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxypyrrolidinium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,4-Pyrrolidinediol, 2-[(1S)-1,2-dihydroxyethyl]-, hydrochloride (1:1), (2R,3S,4R)-
CAS:Formula:C6H14ClNO4Color and Shape:SolidMolecular weight:199.63271,4-Dideoxy-1,4-imino-D-mannitol HCl
CAS:<p>1,4-Dideoxy-1,4-imino-D-mannitol HCl is a custom synthesis, modification and fluorination of mannitol. This compound is synthesized by the click modification of a monosaccharide and oligosaccharide. It is a saccharide with an average molecular weight of 584.45 g/mol. 1,4-Dideoxy-1,4-imino-D-mannitol HCl has been used to study glycosylation and sugar binding in carbohydrate research. CAS No.: 114976-76-0</p>Formula:C6H13NO4·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:199.63 g/mol


