CAS 114980-23-3
:3,5-DIMETHOXY-THIOBENZAMIDE
Description:
3,5-Dimethoxy-thiobenzamide is an organic compound characterized by the presence of a thiobenzamide functional group, which consists of a benzene ring substituted with two methoxy groups at the 3 and 5 positions, and a thiocarbonyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic and methoxy substituents. The methoxy groups enhance its electron-donating properties, potentially influencing its reactivity and interactions with biological targets. As a thiobenzamide, it may exhibit specific biological activities, including potential roles in medicinal chemistry, although detailed pharmacological data may vary. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in synthetic organic chemistry. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C9H11NO2S
InChI:InChI=1/C9H11NO2S/c1-11-7-3-6(9(10)13)4-8(5-7)12-2/h3-5H,1-2H3,(H2,10,13)
SMILES:COc1cc(cc(c1)OC)C(=N)S
Synonyms:- Benzenecarbothioamide, 3,5-dimethoxy- (9CI)
- 3,5-Dimethoxybenzenecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
