CAS 114991-16-1
:5-amino-2-[2-(methylamino)ethyl]benzo[de]isoquinoline-1,3-dione
Description:
5-amino-2-[2-(methylamino)ethyl]benzo[de]isoquinoline-1,3-dione, with the CAS number 114991-16-1, is a synthetic organic compound characterized by its complex structure, which includes an isoquinoline core. This compound features an amino group and a methylamino substituent, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar organic solvents. The presence of the benzoisoquinoline moiety suggests that it may possess interesting pharmacological properties, potentially acting as a ligand for various biological targets. Its molecular structure indicates that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and biological function. As with many compounds of this nature, its stability, reactivity, and potential applications in medicinal chemistry would depend on specific conditions such as pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential uses in research or therapeutic contexts.
Formula:C15H15N3O2
InChI:InChI=1/C15H15N3O2/c1-17-5-6-18-14(19)11-4-2-3-9-7-10(16)8-12(13(9)11)15(18)20/h2-4,7-8,17H,5-6,16H2,1H3
SMILES:CNCCn1c(=O)c2cccc3cc(cc(c23)c1=O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1H-Benz[de]isoquinoline-1,3(2H)-dione, 5-amino-2-[2-(methylamino)ethyl]-
CAS:Formula:C15H15N3O2Molecular weight:269.2985N’-Desmethyl Amonafide
CAS:Controlled Product<p>Applications A metabolite of Amonafide.<br>References Felder, T.B., et al.: Drug Metab. Dispos., 15, 773 (1987), Frei, E., et al.: Cancer Res., 48, 6417 (1988), Liu, Y., et al.: Bioorg. Med. Chem., 14, 2935 (2006),<br></p>Formula:C15H15N3O2Color and Shape:NeatMolecular weight:269.298

