CAS 114991-27-4
:1,4-Benzenediol, 2,6-bis(1-methylethyl)-, 4-(hydrogen sulfate)
Description:
1,4-Benzenediol, 2,6-bis(1-methylethyl)-, 4-(hydrogen sulfate), also known as a derivative of bisphenol, is a chemical compound characterized by its aromatic structure featuring two hydroxyl groups and a hydrogen sulfate group. This compound typically exhibits properties associated with both phenolic compounds and sulfonic acids, which can influence its solubility and reactivity. It is likely to be a white to off-white solid at room temperature, with potential applications in various industrial processes, including as an intermediate in the synthesis of other chemicals or materials. The presence of the hydrogen sulfate group suggests it may have acidic properties, which can affect its behavior in chemical reactions and interactions with other substances. Additionally, the branched alkyl groups contribute to its hydrophobic characteristics, potentially impacting its solubility in organic solvents versus water. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C12H18O5S
InChI:InChI=1S/C12H18O5S/c1-7(2)10-5-9(17-18(14,15)16)6-11(8(3)4)12(10)13/h5-8,13H,1-4H3,(H,14,15,16)
InChI key:InChIKey=RKAQPQOYAJQIAA-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)O)C1=CC(C(C)C)=C(O)C(C(C)C)=C1
Synonyms:- 1,4-Benzenediol, 2,6-bis(1-methylethyl)-, 4-(hydrogen sulfate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Hydroxy Propofol Sulfate Sodium Salt
CAS:Applications 4-Hydroxy Propofol sulfate sodium salt is a derivative of Propofol, a hypnotic intravenous agent that is commonly used as an anasthetic for conscious sedation.
References GüLCIN, I., et al.: Chem. Pharm. Bull., 53, 281 (2005); Koshy, G., et al.: Am. J. Gastroenterol., 95, 1476 (2000)Formula:C12H17NaO5SColor and Shape:NeatMolecular weight:296.32

