CAS 114996-72-4
:4-(fluoromethyl)benzoylformate
Description:
4-(Fluoromethyl)benzoylformate, with the CAS number 114996-72-4, is an organic compound characterized by the presence of a fluoromethyl group attached to a benzoylformate structure. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. The presence of the fluoromethyl group can influence its reactivity and polarity, potentially enhancing its lipophilicity compared to non-fluorinated analogs. The benzoylformate moiety suggests that it may participate in various chemical reactions, including esterification and acylation, making it useful in synthetic organic chemistry. Additionally, the fluorine atom can impart unique properties, such as increased stability and altered electronic characteristics, which may be beneficial in pharmaceutical applications or material science. As with many fluorinated compounds, it is essential to handle 4-(fluoromethyl)benzoylformate with care, considering potential toxicity and environmental impact. Overall, its unique structural features make it a compound of interest in various chemical research fields.
Formula:C9H7FO3
InChI:InChI=1/C9H7FO3/c10-5-6-1-3-7(4-2-6)8(11)9(12)13/h1-4H,5H2,(H,12,13)
SMILES:c1cc(ccc1CF)C(=O)C(=O)O
Synonyms:- FMeBF
- [4-(Fluoromethyl)Phenyl](Oxo)Acetic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
