CAS 115-24-2
:2,2-Bis(ethylsulfonyl)propane
Description:
2,2-Bis(ethylsulfonyl)propane, with the CAS number 115-24-2, is an organic compound characterized by its sulfonyl functional groups attached to a propane backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its high thermal stability and is often utilized as a reagent in organic synthesis, particularly in the formation of sulfonyl derivatives. The presence of ethylsulfonyl groups imparts unique chemical reactivity, making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, it exhibits moderate solubility in polar solvents, which can facilitate its use in diverse chemical reactions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2,2-Bis(ethylsulfonyl)propane is a valuable compound in synthetic chemistry, contributing to the development of more complex molecular structures.
Formula:C7H16O4S2
InChI:InChI=1S/C7H16O4S2/c1-5-12(8,9)7(3,4)13(10,11)6-2/h5-6H2,1-4H3
InChI key:InChIKey=CESKLHVYGRFMFP-UHFFFAOYSA-N
SMILES:C(S(CC)(=O)=O)(S(CC)(=O)=O)(C)C
Synonyms:- 2,2-Bis(ethanesulfonyl)propane
- 2,2-bis (Ethylsulfonyl) propane
- 2-Propanone, bis(ethyl sulfone)
- Acetone diethyl sulfone
- Acetone, bis(ethyl sulfone)
- NSC 26248
- Propane, 2,2-bis(ethylsulfonyl)-
- Propane-diethylsulfone
- Sulfonal
- Sulphonal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

