CAS 115-58-2
:5-Ethyl-5-pentyl-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
5-Ethyl-5-pentyl-2,4,6(1H,3H,5H)-pyrimidinetrione, with CAS number 115-58-2, is a chemical compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing nitrogen atoms. This substance features a trione functional group, indicating the presence of three carbonyl (C=O) groups, which contributes to its reactivity and potential applications in various chemical reactions. The ethyl and pentyl substituents enhance its hydrophobic properties, influencing its solubility and interaction with biological systems. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The structural configuration of the pyrimidinetrione core allows for potential tautomeric forms, which can affect its chemical behavior. Additionally, the compound's stability, melting point, and boiling point are influenced by the substituents and the overall molecular structure. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C11H18N2O3
InChI:InChI=1S/C11H18N2O3/c1-3-5-6-7-11(4-2)8(14)12-10(16)13-9(11)15/h3-7H2,1-2H3,(H2,12,13,14,15,16)
InChI key:InChIKey=XYGXSCVUMIDZRR-UHFFFAOYSA-N
SMILES:C(CCCC)C1(CC)C(=O)NC(=O)NC1=O
Synonyms:- 5-Ethyl-5-pentyl-2,4,6(1H,3H,5H)-pyrimidinetrione
- Barbituric acid, 5-ethyl-5-pentyl-
- Barbituric acid, 5-amyl-5-ethyl-
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-5-pentyl-
- 5-Ethyl-5-pentylbarbituric acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
