
CAS 115-78-6
:Phosphon
Description:
The chemical substance known as "Phosphon," with the CAS number 115-78-6, is more commonly referred to as phosphonic acid or phosphonic acid derivatives. It is characterized by the presence of a phosphorus atom bonded to a hydroxyl group and two oxygen atoms, typically in the form of phosphonate groups. Phosphon compounds are known for their ability to form stable complexes with metal ions, making them useful in various applications, including agriculture as herbicides and in water treatment processes. They exhibit moderate acidity and can act as chelating agents. Additionally, phosphonates are often utilized in the synthesis of pharmaceuticals and as additives in detergents due to their surfactant properties. The stability of the phosphorus-carbon bond in certain phosphonates also makes them valuable in organic synthesis. Overall, phosphon compounds play a significant role in both industrial and agricultural chemistry due to their diverse functional properties and reactivity.
Formula:C19H32Cl2P·Cl
InChI:InChI=1S/C19H32Cl2P.ClH/c1-4-7-12-22(13-8-5-2,14-9-6-3)16-17-10-11-18(20)15-19(17)21;/h10-11,15H,4-9,12-14,16H2,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=IVHVNMLJNASKHW-UHFFFAOYSA-M
SMILES:[P+](CC1=C(Cl)C=C(Cl)C=C1)(CCCC)(CCCC)CCCC.[Cl-]
Synonyms:- 2,4-Dichlorobenzyltributylphosphonium chloride
- Phosphonium, tributyl[(2,4-dichlorophenyl)methyl]-, chloride (1:1)
- Tributyl(2,4-dichlorobenzyl)phosphonium chloride
- Phosphonium, tributyl(2,4-dichlorobenzyl)-, chloride
- Phosphonium, tributyl[(2,4-dichlorophenyl)methyl]-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phosphonium, tributyl[(2,4-dichlorophenyl)methyl]-, chloride (1:1)
CAS:Formula:C19H32Cl3PMolecular weight:397.7901
