CAS 115-85-5
:Phosphoric acid, 2-chlorophenyl diphenyl ester
Description:
Phosphoric acid, 2-chlorophenyl diphenyl ester, commonly known as phenyl phosphate, is an organophosphate compound characterized by its ester functional groups derived from phosphoric acid. It appears as a colorless to pale yellow liquid with a relatively high boiling point and low volatility. This compound is known for its applications as a plasticizer, flame retardant, and in various industrial processes. It exhibits moderate toxicity and can pose environmental hazards, particularly to aquatic life. The presence of the 2-chlorophenyl group contributes to its chemical reactivity and potential for bioaccumulation. In terms of solubility, it is generally soluble in organic solvents but has limited solubility in water. Safety precautions are essential when handling this substance, as it can cause irritation to the skin, eyes, and respiratory system. Overall, phosphoric acid, 2-chlorophenyl diphenyl ester is a significant compound in both industrial applications and research, necessitating careful management due to its chemical properties and potential health impacts.
Formula:C18H14ClO4P
InChI:InChI=1S/C18H14ClO4P/c19-17-13-7-8-14-18(17)23-24(20,21-15-9-3-1-4-10-15)22-16-11-5-2-6-12-16/h1-14H
InChI key:InChIKey=NMPAICLYKOKXAP-UHFFFAOYSA-N
SMILES:P(OC1=C(Cl)C=CC=C1)(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O
Synonyms:- Phosphoric acid, 2-chlorophenyl diphenyl ester
- NSC 2861
- o-Chlorophenyl diphenyl phosphate
- Phosphoric acid, o-chlorophenyl diphenyl ester
- (2-Chlorophenyl) diphenyl phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
