CAS 115-86-6: Triphenyl phosphate

Description:Triphenyl phosphate (TPP), with the CAS number 115-86-6, is an organophosphate compound characterized by its three phenyl groups attached to a phosphate group. It is a colorless to pale yellow liquid at room temperature and is known for its low volatility and high thermal stability. TPP is primarily used as a flame retardant in various materials, including plastics, textiles, and coatings, due to its ability to inhibit combustion. Additionally, it serves as a plasticizer, enhancing the flexibility and durability of polymers. Triphenyl phosphate is soluble in organic solvents but has limited solubility in water, which influences its environmental behavior. It is also recognized for its potential toxicity and environmental persistence, raising concerns regarding its impact on aquatic life and human health. As a result, regulatory measures are being considered in various jurisdictions to manage its use and mitigate risks associated with exposure. Overall, TPP plays a significant role in industrial applications while necessitating careful handling and assessment of its environmental effects.

Formula:C₁₈H₁₅O₄P

InChI:InChI=1S/C18H15O4P/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H

InChI key:InChIKey=XZZNDPSIHUTMOC-UHFFFAOYSA-N

SMILES:O=P(OC=1C=CC=CC1)(OC=2C=CC=CC2)OC=3C=CC=CC3