
CAS 115-98-0
:Bis(2-chloroethyl) P-ethenylphosphonate
Description:
Bis(2-chloroethyl) P-ethenylphosphonate, with the CAS number 115-98-0, is an organophosphorus compound characterized by its phosphonate structure, which includes a phosphorus atom bonded to an ethenyl group and two 2-chloroethyl groups. This compound is typically a colorless to pale yellow liquid and is known for its reactivity due to the presence of both the phosphorus atom and the chloroethyl groups. It is soluble in organic solvents but has limited solubility in water. The compound is primarily used in organic synthesis and as an intermediate in the production of various chemicals, including pesticides and pharmaceuticals. Its chemical properties allow it to participate in nucleophilic substitution reactions, making it valuable in the synthesis of more complex molecules. However, due to the presence of chlorine, it may pose environmental and health risks, necessitating careful handling and disposal. As with many organophosphorus compounds, it is important to consider its potential toxicity and regulatory status in various applications.
Formula:C6H11Cl2O3P
InChI:InChI=1S/C6H11Cl2O3P/c1-2-12(9,10-5-3-7)11-6-4-8/h2H,1,3-6H2
InChI key:InChIKey=LHHMNJZNWUJFOC-UHFFFAOYSA-N
SMILES:P(OCCCl)(OCCCl)(C=C)=O
Synonyms:- Phosphonic acid, P-ethenyl-, bis(2-chloroethyl) ester
- Phosphonic acid, vinyl-, bis(2-chloroethyl) ester
- Phosphonic acid, ethenyl-, bis(2-chloroethyl) ester
- Bis(β-chloroethyl) vinylphosphonate
- Bis(2-chloroethyl) P-ethenylphosphonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.