CAS 1150114-25-2
:Thiocyanic acid, 4-amino-2,5-difluorophenyl ester, hydrochloride (1:1)
Description:
Thiocyanic acid, 4-amino-2,5-difluorophenyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group derived from thiocyanic acid and a substituted aromatic amine. The presence of the 4-amino group and two fluorine atoms on the phenyl ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity due to the presence of the amino group, which can participate in hydrogen bonding and other interactions. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the molecular structure and intermolecular forces present. Safety data and handling precautions should be considered, as with any chemical substance, particularly those involving thiocyanate groups, which can be toxic in certain concentrations.
Formula:C7H4F2N2S·ClH
InChI:InChI=1S/C7H4F2N2S.ClH/c8-4-2-7(12-3-10)5(9)1-6(4)11;/h1-2H,11H2;1H
InChI key:InChIKey=JHSXQAMCTCNIDG-UHFFFAOYSA-N
SMILES:S(C#N)C1=C(F)C=C(N)C(F)=C1.Cl
Synonyms:- Thiocyanic acid, 4-amino-2,5-difluorophenyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
