CAS 1150114-26-3
:4-Bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitrobenzenamine
Description:
4-Bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a fluorine atom, and a nitro group attached to a benzene ring. The presence of the bulky tert-butyl group (1,1-dimethylethyl) contributes to its steric properties, potentially influencing its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of electronegative halogens and the nitro group, which can participate in hydrogen bonding. The nitro group also suggests potential for electrophilic aromatic substitution reactions. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the presence of functional groups that are often found in biologically active molecules. Safety data should be reviewed, as halogenated compounds can pose environmental and health risks. Overall, the unique combination of substituents in this compound makes it a subject of interest in synthetic organic chemistry.
Formula:C10H12BrFN2O2
InChI:InChI=1S/C10H12BrFN2O2/c1-10(2,3)13-8-5-7(12)6(11)4-9(8)14(15)16/h4-5,13H,1-3H3
InChI key:InChIKey=HNSIZDZRAOLNCA-UHFFFAOYSA-N
SMILES:N(C(C)(C)C)C1=C(N(=O)=O)C=C(Br)C(F)=C1
Synonyms:- 4-Bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitrobenzenamine
- Benzenamine, 4-bromo-N-(1,1-dimethylethyl)-5-fluoro-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
