CAS 1150114-82-1

2-Bromo-N-ethylbenzeneacetamide

Description:

2-Bromo-N-ethylbenzeneacetamide is an organic compound characterized by its structure, which includes a bromine atom, an ethyl group, and an acetamide functional group attached to a benzene ring. This compound typically exhibits properties common to aromatic amides, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine substituent, which can participate in nucleophilic substitution reactions. The ethyl group contributes to the hydrophobic character of the molecule, influencing its solubility and interaction with biological systems. The presence of the acetamide group suggests potential applications in medicinal chemistry, as amides often play a role in drug design due to their ability to form hydrogen bonds. Additionally, the bromine atom can enhance the compound's biological activity or serve as a handle for further chemical modifications. Overall, 2-Bromo-N-ethylbenzeneacetamide is a compound of interest in synthetic organic chemistry and pharmacology, with properties that may be explored for various applications.

Formula: C₁₀H₁₂BrNO

InChI: InChI=1S/C10H12BrNO/c1-2-12-10(13)7-8-5-3-4-6-9(8)11/h3-6H,2,7H2,1H3,(H,12,13)

InChI key: InChIKey=HYTTXEGJFDEPEQ-UHFFFAOYSA-N

SMILES: C(C(NCC)=O)C1=C(Br)C=CC=C1

Synonyms:

• 2-(2-Bromophenyl)-N-ethylacetamide
• Benzeneacetamide, 2-bromo-N-ethyl-
• 2-Bromo-N-ethylbenzeneacetamide

Ethyl 2-(2-bromophenyl)acetamide

CAS: 1150114-82-1

Formula: C₁₀H₁₂BrNO

Molecular weight: 242.1124

Ref: IN-DA000FMX