
CAS 115012-10-7
:5,6-Dihydro-5-hydroxy-7H-pyrrolo[3,4-b]pyridin-7-one
Description:
5,6-Dihydro-5-hydroxy-7H-pyrrolo[3,4-b]pyridin-7-one, with the CAS number 115012-10-7, is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a hydroxyl group at the 5-position and a carbonyl group at the 7-position, contributing to its reactivity and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. The fused ring system provides structural rigidity, which can be important for the compound's pharmacological properties. It may exhibit various biological activities, including potential neuroprotective effects, making it of interest in medicinal chemistry. Additionally, the compound's unique structure may allow for further derivatization, leading to the development of novel therapeutic agents. Overall, 5,6-Dihydro-5-hydroxy-7H-pyrrolo[3,4-b]pyridin-7-one represents a significant scaffold for research in drug discovery and development.
Formula:C7H6N2O2
InChI:InChI=1S/C7H6N2O2/c10-6-4-2-1-3-8-5(4)7(11)9-6/h1-3,6,10H,(H,9,11)
InChI key:InChIKey=VZXZMFFSCIDRPJ-UHFFFAOYSA-N
SMILES:OC1C=2C(C(=O)N1)=NC=CC2
Synonyms:- 5,6-Dihydro-5-hydroxy-7H-pyrrolo[3,4-b]pyridin-7-one
- 7H-Pyrrolo[3,4-b]pyridin-7-one, 5,6-dihydro-5-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
