CAS 115012-26-5: 3-Amino-N-cyclohexylpropanamide

Description:3-Amino-N-cyclohexylpropanamide, with the CAS number 115012-26-5, is an organic compound characterized by the presence of an amino group and a cyclohexyl group attached to a propanamide backbone. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the amine functional group, which can engage in hydrogen bonding. The cyclohexyl group contributes to its hydrophobic character, influencing its overall solubility and reactivity. The amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a potential candidate for applications in pharmaceuticals and organic synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its structural features suggest that it may have a role in modulating biological pathways or interactions, although specific biological activities would require further investigation. Overall, 3-Amino-N-cyclohexylpropanamide represents a versatile structure within the realm of organic chemistry.

Formula:C₉H₁₈N₂O

InChI:InChI=1S/C9H18N2O/c10-7-6-9(12)11-8-4-2-1-3-5-8/h8H,1-7,10H2,(H,11,12)

InChI key:InChIKey=OHYOQNYNFIQCLU-UHFFFAOYSA-N

SMILES:O=C(NC1CCCCC1)CCN

Synonyms:
3-Amino-N-cyclohexyl-propionamide
Propanamide, 3-amino-N-cyclohexyl-
3-Amino-N-cyclohexylpropanamide

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Propanamide, 3-amino-N-cyclohexyl- REF: IN-DA000FNGCAS: 115012-26-5	- - -	To inquire	Fri 28 Mar 25
3-Amino-n-cyclohexylpropanamide REF: 10-F640458CAS: 115012-26-5	95+%	- - -	Discontinued product
3-Amino-N-cyclohexylpropanamide REF: 3D-QEA01226CAS: 115012-26-5	Min. 95%	- - -	Discontinued product