CAS 115016-95-0
:(S)-2-Hydroxy-4-phenylbutyric acid
Description:
(S)-2-Hydroxy-4-phenylbutyric acid, also known as (S)-HPB, is a chiral compound characterized by its hydroxyl and carboxylic acid functional groups. It features a four-carbon backbone with a phenyl group attached to the second carbon, contributing to its aromatic properties. The presence of the hydroxyl group imparts polarity, enhancing its solubility in polar solvents, while the carboxylic acid group can participate in hydrogen bonding and acid-base reactions. This compound is often studied for its potential biological activities, including anti-inflammatory and analgesic effects, making it of interest in pharmaceutical research. Its stereochemistry, indicated by the (S) configuration, is crucial for its biological activity, as enantiomers can exhibit different pharmacological profiles. The CAS number 115016-95-0 uniquely identifies this compound in chemical databases, facilitating its study and application in various fields, including medicinal chemistry and drug development. Overall, (S)-2-Hydroxy-4-phenylbutyric acid represents a significant compound with diverse applications due to its structural characteristics and biological relevance.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5,9,11H,6-7H2,(H,12,13)/t9-/m0/s1
SMILES:c1ccc(cc1)CC[C@@H](C(=O)O)O
Synonyms:- 2-(S)-Hydroxy-4-Phenyl-Butyric Acid
- (2S)-2-hydroxy-4-phenylbutanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenebutanoic acid, α-hydroxy-, (αS)-
CAS:Formula:C10H12O3Purity:97%Color and Shape:SolidMolecular weight:180.2005(S)-2-Hydroxy-4-phenylbutyric acid
CAS:(S)-2-Hydroxy-4-phenylbutyric acidPurity:97%Molecular weight:180.20g/mol(S)-2-Hydroxy-4-phenylbutyric Acid
CAS:Controlled ProductApplications Used in the preparation of benzothiophenes, benzofurans, and indoles useful in the treatment of insulin resistance and hyperglycemia.
References Chang, A., et al.: Diabetes, 32, 830 (1983), Goldstein, B. et al.: Cell Biochem., 48, 33 (1992), Sredy, J., et al.: Metabolism, 44, 1074 (1995),Formula:C10H12O3Color and Shape:NeatMolecular weight:180.2(S)-2-Hydroxy-4-phenylbutyric acid
CAS:Formula:C10H12O3Purity:97%Color and Shape:White to almost white powderMolecular weight:180.203



