
CAS 1150163-74-8
:Pyridine, 3-fluoro-2-methoxy-, hydrochloride (1:1)
Description:
Pyridine, 3-fluoro-2-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a methoxy group (-OCH3) at the 2-position contributes to its unique chemical properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular interactions can be influenced by the electronegative fluorine and the methoxy group, potentially affecting its reactivity and binding affinity in biological systems. Safety data should be consulted for handling, as with many nitrogen-containing heterocycles, it may pose health risks if ingested or inhaled. Overall, this compound serves as a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C6H6FNO·ClH
InChI:InChI=1S/C6H6FNO.ClH/c1-9-6-5(7)3-2-4-8-6;/h2-4H,1H3;1H
InChI key:InChIKey=WGZVIKBJRSRRCY-UHFFFAOYSA-N
SMILES:O(C)C1=C(F)C=CC=N1.Cl
Synonyms:- Pyridine, 3-fluoro-2-methoxy-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
