CymitQuimica logo

CAS 1150163-77-1

:

Methyl 3-(4-bromophenyl)-1H-pyrazole-4-carboxylate

Description:
Methyl 3-(4-bromophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromophenyl group at the 3-position of the pyrazole ring contributes to its aromatic properties and may influence its reactivity and biological activity. The carboxylate functional group at the 4-position, esterified with a methyl group, enhances its solubility in organic solvents and may play a role in its interactions with biological targets. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its molecular structure suggests that it may exhibit specific pharmacological activities, although detailed studies would be necessary to elucidate its biological effects and mechanisms of action. Additionally, the presence of bromine may impart unique electronic properties, making it a candidate for further research in various chemical applications.
Formula:C11H9BrN2O2
InChI:InChI=1S/C11H9BrN2O2/c1-16-11(15)9-6-13-14-10(9)7-2-4-8(12)5-3-7/h2-6H,1H3,(H,13,14)
InChI key:InChIKey=NSBZXLIETBYGKD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=NNC1)C2=CC=C(Br)C=C2
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 3-(4-bromophenyl)-, methyl ester
  • Methyl 3-(4-bromophenyl)-1H-pyrazole-4-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.