CymitQuimica logo

CAS 1150163-97-5

:

Ethyl 5-amino-1-(2-bromophenyl)-4-cyano-1H-pyrazole-3-carboxylate

Description:
Ethyl 5-amino-1-(2-bromophenyl)-4-cyano-1H-pyrazole-3-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring, an amino group, and a cyano group, along with an ethyl ester functional group. The presence of the 2-bromophenyl substituent introduces a halogen, which can influence the compound's reactivity and biological activity. This compound is typically used in medicinal chemistry and may exhibit various pharmacological properties due to its unique structural features. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Safety data should be consulted for handling, as the presence of bromine and cyano groups can pose health risks. Overall, this compound represents a class of pyrazole derivatives that are valuable in research and potential therapeutic applications.
Formula:C13H11BrN4O2
InChI:InChI=1S/C13H11BrN4O2/c1-2-20-13(19)11-8(7-15)12(16)18(17-11)10-6-4-3-5-9(10)14/h3-6H,2,16H2,1H3
InChI key:InChIKey=ZZNNLYKYVWSFEK-UHFFFAOYSA-N
SMILES:NC=1N(N=C(C(OCC)=O)C1C#N)C2=C(Br)C=CC=C2
Synonyms:
  • Ethyl 5-amino-1-(2-bromophenyl)-4-cyano-1H-pyrazole-3-carboxylate
  • 1H-Pyrazole-3-carboxylic acid, 5-amino-1-(2-bromophenyl)-4-cyano-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.