CAS 1150164-02-5
:Methyl 3-(4-methylphenyl)-1H-pyrazole-4-carboxylate
Description:
Methyl 3-(4-methylphenyl)-1H-pyrazole-4-carboxylate is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group attached to the phenyl ring, enhancing its hydrophobic properties and potentially influencing its biological activity. The carboxylate functional group contributes to its reactivity and solubility in polar solvents. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the methylphenyl substituent can affect the compound's electronic properties and steric hindrance, which may play a role in its interactions with biological targets. Additionally, the methyl ester group suggests that it may undergo hydrolysis to yield the corresponding carboxylic acid, which can further participate in various chemical reactions. Overall, Methyl 3-(4-methylphenyl)-1H-pyrazole-4-carboxylate is a versatile compound with potential applications in drug development and organic synthesis.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c1-8-3-5-9(6-4-8)11-10(7-13-14-11)12(15)16-2/h3-7H,1-2H3,(H,13,14)
InChI key:InChIKey=QFJFTEZGHXIRDU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=NNC1)C2=CC=C(C)C=C2
Synonyms:- Methyl 3-(4-methylphenyl)-1H-pyrazole-4-carboxylate
- 1H-Pyrazole-4-carboxylic acid, 3-(4-methylphenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
