CymitQuimica logo

CAS 1150164-23-0

:

N-Cyclopropyl-5-nitro-6-quinolinamine

Description:
N-Cyclopropyl-5-nitro-6-quinolinamine is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with a nitro group and a cyclopropyl amine. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the nitro group often enhances the compound's electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the cyclopropyl group can influence the compound's steric and electronic properties, potentially affecting its interaction with biological targets. Such compounds are of interest in medicinal chemistry due to their potential pharmacological activities, including antimicrobial or anticancer properties. The specific solubility, melting point, and stability of N-Cyclopropyl-5-nitro-6-quinolinamine would depend on its molecular interactions and the environment in which it is studied. Overall, this compound represents a fascinating area of research in the development of new therapeutic agents.
Formula:C12H11N3O2
InChI:InChI=1S/C12H11N3O2/c16-15(17)12-9-2-1-7-13-10(9)5-6-11(12)14-8-3-4-8/h1-2,5-8,14H,3-4H2
InChI key:InChIKey=IMSZYKNXWJNSHR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C=CC1NC3CC3)N=CC=C2
Synonyms:
  • 6-Quinolinamine, N-cyclopropyl-5-nitro-
  • N-Cyclopropyl-5-nitro-6-quinolinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.