CAS 1150164-31-0: Ethyl 1-(3-chloro-2-pyridinyl)-5-methyl-1H-pyrazole-4-carboxylate
Description:Ethyl 1-(3-chloro-2-pyridinyl)-5-methyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the chloro substituent on the pyridine ring may influence its reactivity and interaction with biological targets. Ethyl esters, like the one in this compound, are often used in medicinal chemistry due to their ability to undergo hydrolysis to yield carboxylic acids, which can be biologically active. The specific arrangement of functional groups in this molecule suggests potential applications in pharmaceuticals, particularly in the development of agrochemicals or therapeutic agents. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for its practical applications, although these specific values would need to be referenced from experimental data or literature for precise information.
Formula:C12H12ClN3O2
InChI:InChI=1S/C12H12ClN3O2/c1-3-18-12(17)9-7-15-16(8(9)2)11-10(13)5-4-6-14-11/h4-7H,3H2,1-2H3
InChI key:InChIKey=DRAKSNGEBKYYIY-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1C=NN(C2=NC=CC=C2Cl)C1C
- Synonyms:
- 1H-Pyrazole-4-carboxylic acid, 1-(3-chloro-2-pyridinyl)-5-methyl-, ethyl ester
- Ethyl 1-(3-chloro-2-pyridinyl)-5-methyl-1H-pyrazole-4-carboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-Pyrazole-4-carboxylic acid, 1-(3-chloro-2-pyridinyl)-5-methyl-, ethyl ester REF: IN-DA000FNQCAS: 1150164-31-0 | - - - | To inquire | Fri 28 Mar 25 |
 | Ethyl 1-(3-chloropyridin-2-yl)-5-methyl-1H-pyrazole-4-carboxylate REF: 10-F212431CAS: 1150164-31-0 | 95.0% | - - - | Discontinued product |
 | Ethyl 1-(3-chloropyridin-2-yl)-5-methylpyrazole-4-carboxylate REF: 3D-AWB16431CAS: 1150164-31-0 | Min. 95% | - - - | Discontinued product |
1H-Pyrazole-4-carboxylic acid, 1-(3-chloro-2-pyridinyl)-5-methyl-, ethyl ester
Ref: IN-DA000FNQ
| Undefined size | To inquire |
Ethyl 1-(3-chloropyridin-2-yl)-5-methyl-1H-pyrazole-4-carboxylate
Ref: 10-F212431
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
Ethyl 1-(3-chloropyridin-2-yl)-5-methylpyrazole-4-carboxylate
Ref: 3D-AWB16431
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
