CymitQuimica logo

CAS 1150164-34-3

:

Methyl 1-(6-chloro-2-pyridinyl)-5-cyclopropyl-1H-pyrazole-4-carboxylate

Description:
Methyl 1-(6-chloro-2-pyridinyl)-5-cyclopropyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a pyridine moiety, and a cyclopropyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in pharmaceutical research. The presence of the chloro substituent on the pyridine ring may influence its reactivity and interaction with biological targets. As an ester, it may also undergo hydrolysis under certain conditions, releasing methanol and forming the corresponding acid. The compound's molecular structure suggests it may possess specific binding affinities, potentially acting as an inhibitor or modulator in various biochemical pathways. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound represents a class of molecules that could be explored for therapeutic applications, particularly in the context of drug discovery and development.
Formula:C13H12ClN3O2
InChI:InChI=1S/C13H12ClN3O2/c1-19-13(18)9-7-15-17(12(9)8-5-6-8)11-4-2-3-10(14)16-11/h2-4,7-8H,5-6H2,1H3
InChI key:InChIKey=NJRVEUOGPKCDEZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N(N=C1)C=2N=C(Cl)C=CC2)C3CC3
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 1-(6-chloro-2-pyridinyl)-5-cyclopropyl-, methyl ester
  • Methyl 1-(6-chloro-2-pyridinyl)-5-cyclopropyl-1H-pyrazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.