CAS 1150164-48-9
:Methyl 5-cyclopropyl-1-phenyl-1H-pyrazole-4-carboxylate
Description:
Methyl 5-cyclopropyl-1-phenyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its unique pyrazole structure, which includes a cyclopropyl group and a phenyl group. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the cyclopropyl ring introduces strain, which can influence the compound's stability and reactivity. The phenyl group adds aromatic characteristics, potentially enhancing interactions with biological targets. Methyl esters, like this compound, are often used in organic synthesis and can serve as intermediates in the production of pharmaceuticals or agrochemicals. The compound's specific properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Additionally, its biological activity, if any, would be of interest in medicinal chemistry, particularly in the context of drug design and development. Overall, this compound exemplifies the complexity and diversity found in organic chemistry.
Formula:C14H14N2O2
InChI:InChI=1S/C14H14N2O2/c1-18-14(17)12-9-15-16(13(12)10-7-8-10)11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3
InChI key:InChIKey=HHMVYCHDQQBZOB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N(N=C1)C2=CC=CC=C2)C3CC3
Synonyms:- Methyl 5-cyclopropyl-1-phenyl-1H-pyrazole-4-carboxylate
- 1H-Pyrazole-4-carboxylic acid, 5-cyclopropyl-1-phenyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
