CAS 1150164-52-5

3-Chloro-2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]pyridine

Description:

3-Chloro-2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and a pyrazole moiety. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen and nitrogen-containing functional groups. It may be utilized in various applications, including pharmaceuticals and agrochemicals, owing to its potential as a bioactive molecule. The specific interactions and stability of this compound can be influenced by environmental factors such as pH and temperature. Additionally, its synthesis often involves multi-step organic reactions, highlighting its complexity and the need for careful handling in laboratory settings. As with many halogenated compounds, it is essential to consider its environmental impact and regulatory status during use and disposal.

Formula: C₁₀H₇ClF₃N₃

InChI: InChI=1S/C10H7ClF3N3/c1-6-5-8(10(12,13)14)17(16-6)9-7(11)3-2-4-15-9/h2-5H,1H3

InChI key: InChIKey=ZOXBRSXKCLFROC-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N(N=C(C)C1)C2=C(Cl)C=CC=N2

Synonyms:

• Pyridine, 3-chloro-2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-
• 3-Chloro-2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]pyridine
• 3-Chloro-2-(3-methyl-5-(trifluoromethyl)pyrazol-1-yl)pyridine

3-Chloro-2-(3-methyl-5-(trifluoromethyl)pyrazol-1-yl)pyridine

CAS: 1150164-52-5

Formula: C₁₀H₇ClF₃N₃

Molecular weight: 261.6309

Ref: IN-DA000FOR