CymitQuimica logo

CAS 1150164-66-1

:

Ethyl 5-amino-4-cyano-1-(3-iodophenyl)-1H-pyrazole-3-carboxylate

Description:
Ethyl 5-amino-4-cyano-1-(3-iodophenyl)-1H-pyrazole-3-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring, an amino group, a cyano group, and an ethyl ester functional group. The presence of the 3-iodophenyl substituent introduces significant polarity and potential for reactivity due to the iodine atom, which can influence the compound's biological activity and solubility. This compound is likely to exhibit properties typical of pyrazole derivatives, such as potential pharmacological activity, making it of interest in medicinal chemistry. Its molecular structure suggests it may participate in hydrogen bonding due to the amino and carboxylate groups, which can affect its interactions with biological targets. Additionally, the cyano group can contribute to the compound's electronic properties, potentially enhancing its reactivity in various chemical reactions. Overall, this compound's unique combination of functional groups positions it as a candidate for further research in drug development and synthetic chemistry.
Formula:C13H11IN4O2
InChI:InChI=1S/C13H11IN4O2/c1-2-20-13(19)11-10(7-15)12(16)18(17-11)9-5-3-4-8(14)6-9/h3-6H,2,16H2,1H3
InChI key:InChIKey=SWSBKUAZDUMVBE-UHFFFAOYSA-N
SMILES:NC=1N(N=C(C(OCC)=O)C1C#N)C2=CC(I)=CC=C2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-amino-4-cyano-1-(3-iodophenyl)-, ethyl ester
  • Ethyl 5-amino-4-cyano-1-(3-iodophenyl)-1H-pyrazole-3-carboxylate
  • Ethyl5-amino-4-cyano-1-(3-iodophenyl)pyrazole-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.