CAS 1150164-70-7
:Methyl 1-(5-bromo-2-pyridinyl)-5-(2-chlorophenyl)-1H-pyrazole-4-carboxylate
Description:
Methyl 1-(5-bromo-2-pyridinyl)-5-(2-chlorophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole core substituted with various functional groups. The presence of a bromine atom on the pyridine ring and a chlorine atom on the phenyl group contributes to its unique reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, and its carboxylate ester functionality suggests it may participate in various chemical reactions, including esterification and hydrolysis. The molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heteroatoms and the ability to form hydrogen bonds. Additionally, the compound's lipophilicity and electronic properties may influence its interaction with biological targets. As with many synthetic organic compounds, safety and handling precautions are essential, given the presence of halogenated substituents, which can pose environmental and health risks.
Formula:C16H11BrClN3O2
InChI:InChI=1S/C16H11BrClN3O2/c1-23-16(22)12-9-20-21(14-7-6-10(17)8-19-14)15(12)11-4-2-3-5-13(11)18/h2-9H,1H3
InChI key:InChIKey=HDUIBDOFCKXMDQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N(N=C1)C2=CC=C(Br)C=N2)C3=C(Cl)C=CC=C3
Synonyms:- Methyl 1-(5-bromo-2-pyridinyl)-5-(2-chlorophenyl)-1H-pyrazole-4-carboxylate
- 1H-Pyrazole-4-carboxylic acid, 1-(5-bromo-2-pyridinyl)-5-(2-chlorophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 1-(5-bromopyridin-2-yl)-5-(2-chlorophenyl)pyrazole-4-carboxylate
CAS:Formula:C16H11BrClN3O2Molecular weight:392.6344
