CAS 1150164-84-3
:7-Chloro-8-fluoro-2-(trifluoromethyl)-4-quinolinol
Description:
7-Chloro-8-fluoro-2-(trifluoromethyl)-4-quinolinol is a synthetic organic compound belonging to the quinoline family, characterized by its unique fluorinated and chlorinated substituents. The presence of a chloro group at the 7-position and a fluoro group at the 8-position, along with a trifluoromethyl group at the 2-position, contributes to its distinctive chemical properties, including increased lipophilicity and potential biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry, particularly in the development of antimicrobial or antiviral agents. Its structure suggests potential interactions with biological targets, which can be explored through various assays. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioavailability. The compound's solubility, stability, and reactivity can be influenced by the presence of these halogen substituents, making it a subject of interest in both synthetic and medicinal chemistry. As with many quinoline derivatives, it may also exhibit fluorescence, which can be useful in analytical applications.
Formula:C10H4ClF4NO
InChI:InChI=1S/C10H4ClF4NO/c11-5-2-1-4-6(17)3-7(10(13,14)15)16-9(4)8(5)12/h1-3H,(H,16,17)
InChI key:InChIKey=FUPNDEQEFQAHST-UHFFFAOYSA-N
SMILES:FC=1C2=C(C(O)=CC(C(F)(F)F)=N2)C=CC1Cl
Synonyms:- 4-Quinolinol, 7-chloro-8-fluoro-2-(trifluoromethyl)-
- 7-Chloro-8-fluoro-2-(trifluoromethyl)-4-quinolinol
- 7-Chloro-8-fluoro-2-(trifluoromethyl)quinolin-4-ol
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
