CAS 115021-40-4
:3,3′-(1,2-Ethynediyl)bis[benzaldehyde]
Description:
3,3′-(1,2-Ethynediyl)bis[benzaldehyde], with the CAS number 115021-40-4, is an organic compound characterized by its unique structure featuring two benzaldehyde groups connected by an ethynediyl (acetylene) linkage. This compound typically exhibits properties associated with aldehydes, such as a distinct aromatic odor and reactivity towards nucleophiles due to the presence of the aldehyde functional group. The ethynediyl bridge contributes to its rigidity and potential for forming various derivatives through reactions like cross-coupling or polymerization. In terms of solubility, it is generally soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic aromatic components. The compound may also display interesting photophysical properties, making it a candidate for applications in materials science, particularly in organic electronics or as a building block in organic synthesis. Safety precautions should be observed when handling this compound, as with many organic chemicals, due to potential toxicity and reactivity.
Formula:C16H10O2
InChI:InChI=1S/C16H10O2/c17-11-15-5-1-3-13(9-15)7-8-14-4-2-6-16(10-14)12-18/h1-6,9-12H
InChI key:InChIKey=RMERVORJRCQFPE-UHFFFAOYSA-N
SMILES:C(#CC1=CC(C=O)=CC=C1)C2=CC(C=O)=CC=C2
Synonyms:- Benzaldehyde, 3,3′-(1,2-ethynediyl)bis-
- 3,3′-(1,2-Ethynediyl)bis[benzaldehyde]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
