CAS 115027-18-4
:Ethanone, 2-chloro-1-(6-methyl-1H-indol-3-yl)-
Description:
Ethanone, 2-chloro-1-(6-methyl-1H-indol-3-yl)-, also known by its CAS number 115027-18-4, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a chloro substituent at the 2-position of the ethanone moiety, contributing to its reactivity and potential applications in various chemical reactions. The presence of the 6-methyl group on the indole ring enhances its hydrophobic character and may influence its biological activity. Typically, compounds like this can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups, making it a subject of study in both synthetic and applied chemistry contexts.
Formula:C11H10ClNO
InChI:InChI=1S/C11H10ClNO/c1-7-2-3-8-9(11(14)5-12)6-13-10(8)4-7/h2-4,6,13H,5H2,1H3
InChI key:InChIKey=XVEKDVUZMSRMAJ-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C=1C=2C(NC1)=CC(C)=CC2
Synonyms:- Ethanone, 2-chloro-1-(6-methyl-1H-indol-3-yl)-
- 2-Chloro-1-(6-methyl-1H-indol-3-yl)ethan-1-one
- 2-Chloro-1-(6-methyl-1H-indol-3-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.